| Product Name | 2-Methylphenyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-beta-Dglucopyranoside |
|---|---|
| CAS | 263746-44-7 |
| Formula | C21 H27 N O9 |
| MW | 437.44 |
| MDL | MFCD08703857 |
| Boiling point | 590.7±50.0 °C(Predicted) |
Product Center
| Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
|---|---|---|---|---|---|---|---|---|
|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
||||||||
| Product Name | 2-Methylphenyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-beta-Dglucopyranoside |
|---|---|
| CAS | 263746-44-7 |
| Formula | C21 H27 N O9 |
| MW | 437.44 |
| MDL | MFCD08703857 |
| Boiling point | 590.7±50.0 °C(Predicted) |
| CAS | 263746-44-7 |
|---|---|
| Formula | C21 H27 N O9 |
| MW | 437.44 |
| MDL | MFCD08703857 |
| Boiling point | 590.7±50.0 °C(Predicted) |
| Smiles | [C@H]1([C@@H](OC(=O)C)[C@H](OC(=O)C)[C@@H](COC(=O)C)O[C@H]1OC1=C(C)C=CC=C1)NC(=O)C |&1:0,1,6,11,18,r| |
| InchiKey | KJHQVFWBNCVROC-RFOSDBSWNA-N |