| Product Name | Methyl-2,3,4-tri-O-benzyl-6-chloro-6-deoxy-alpha-D-glucopyranoside |
|---|---|
| CAS | 142543-88-2 |
| Formula | C28 H31 Cl O5 |
| MW | 483.00 |
| Boiling point | 587.2±50.0 °C(Predicted) |
Product Center
| Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
|---|---|---|---|---|---|---|---|---|
|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
||||||||
| Product Name | Methyl-2,3,4-tri-O-benzyl-6-chloro-6-deoxy-alpha-D-glucopyranoside |
|---|---|
| CAS | 142543-88-2 |
| Formula | C28 H31 Cl O5 |
| MW | 483.00 |
| Boiling point | 587.2±50.0 °C(Predicted) |
| CAS | 142543-88-2 |
|---|---|
| Formula | C28 H31 Cl O5 |
| MW | 483.00 |
| Boiling point | 587.2±50.0 °C(Predicted) |
| Smiles | O(CC1=CC=CC=C1)[C@H]1[C@H](OCC2=CC=CC=C2)[C@@H](CCl)O[C@H](OC)[C@@H]1OCC1=CC=CC=C1 |&1:8,9,18,22,25,r| |
| InchiKey | REXYVHONWVLOPT-FAGPOLGCNA-N |