| Product Name | Ioxilan |
|---|---|
| CAS | 107793-72-6 |
| Formula | C18H24I3N3O8 |
| MW | 791.112 |
| Boiling point | 827.8°C at 760 mmHg |
Product Center
| Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
|---|---|---|---|---|---|---|---|---|
|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
||||||||
| Product Name | Ioxilan |
|---|---|
| CAS | 107793-72-6 |
| Formula | C18H24I3N3O8 |
| MW | 791.112 |
| Boiling point | 827.8°C at 760 mmHg |
| CAS | 107793-72-6 |
|---|---|
| Formula | C18H24I3N3O8 |
| MW | 791.112 |
| Boiling point | 827.8°C at 760 mmHg |
| Smiles | O=C(C1C(I)=C(C(=O)NCCO)C(I)=C(N(C(=O)C)CC(CO)O)C=1I)NCC(CO)O |
| InchiKey | UUMLTINZBQPNGF-UHFFFAOYSA-N |