| Product Name | Ceftizoxime sodium |
|---|---|
| Chinese alias | Ceftizoxime sodium |
| CAS | 68401-82-1 |
| Formula | C13H13N5O5S2.Na |
| MW | 405.38 |
| Appearance | white to faint yellow solid |
| MDL | MFCD01682036 |
| Storage condition | ?20°C |
Product Center
MF:
C13H13N5O5S2.Na
MW:
405.38
Characters:white to faint yellow solid
| Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
|---|---|---|---|---|---|---|---|---|
| YB52638 | yunbang | 1g | 95% | $345.83 | Visible after login | Inquiry | ||
| YB52638 | yunbang | 5g | 95% | $810.83 | Visible after login | Inquiry |
| Product Name | Ceftizoxime sodium |
|---|---|
| Chinese alias | Ceftizoxime sodium |
| CAS | 68401-82-1 |
| Formula | C13H13N5O5S2.Na |
| MW | 405.38 |
| Appearance | white to faint yellow solid |
| MDL | MFCD01682036 |
| Storage condition | ?20°C |
| Symbol | N/A |
|---|---|
| Safe Property | 26 |
| Hazard Category Code | 36/37/38 |
| Chinese alias | Ceftizoxime sodium |
|---|---|
| CAS | 68401-82-1 |
| Formula | C13H13N5O5S2.Na |
| MW | 405.38 |
| Appearance | white to faint yellow solid |
| MDL | MFCD01682036 |
| Safe Property | 26 |
| Hazard Category Code | 36/37/38 |
| Water Solubility | DMSO: 1 mg/mL |
| Storage | ?20°C |
| Smiles | O=C1[C@@H](NC(=O)/C(/C2N=C(N)SC=2)=N\OC)[C@@]2([H])SCC=C(C(=O)O)N12.[Na] |^1:26| |
| InchiKey | LNJZODVQDGCASS-LIGXYSTNSA-N |